C44H54N2O9 — CID 140658703
6-methoxy-2-[3-methoxy-4-[10-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]decoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 140658703) has the molecular formula C44H54N2O9 and a molecular weight of 754.92 g/mol. Its IUPAC name is 6-methoxy-2-[3-methoxy-4-[10-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]decoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 6-methoxy-2-[3-methoxy-4-[10-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]decoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 140658703 |
| Molecular Formula | C44H54N2O9 |
| Molecular Weight | 754.92 g/mol |
| Exact Mass | 754.38 |
| IUPAC Name | 6-methoxy-2-[3-methoxy-4-[10-[2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]decoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1ccc2c(c1)C(=O)NC(c1ccc(OCCCCCCCCCCOc3cc(C=Cc4cc(OC)c(OC)c(OC)c4)ccc3OC)c(OC)c1)N2 |
| InChI | InChI=1S/C44H54N2O9/c1-48-33-19-20-35-34(29-33)44(47)46-43(45-35)32-18-22-37(38(28-32)50-3)54-23-13-11-9-7-8-10-12-14-24-55-39-25-30(17-21-36(39)49-2)15-16-31-26-40(51-4)42(53-6)41(27-31)52-5/h15-22,25-29,43,45H,7-14,23-24H2,1-6H3,(H,46,47) |
| InChIKey | IPZXQRYBFLPUBM-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.92 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|