C41H48N2O9 — CID 89070133
2-[4-[4-[2,6-dimethoxy-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexoxy]-3-methoxyphenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 89070133) has the molecular formula C41H48N2O9 and a molecular weight of 712.84 g/mol. Its IUPAC name is 2-[4-[4-[2,6-dimethoxy-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexoxy]-3-methoxyphenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[4-[2,6-dimethoxy-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexoxy]-3-methoxyphenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 89070133 |
| Molecular Formula | C41H48N2O9 |
| Molecular Weight | 712.84 g/mol |
| Exact Mass | 712.34 |
| IUPAC Name | 2-[4-[4-[2,6-dimethoxy-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexoxy]-3-methoxyphenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | CCC(CCCOc1ccc(C2NC(=O)c3cc(C)ccc3N2)cc1OC)Oc1c(OC)cc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C41H48N2O9/c1-9-29(11-10-18-51-32-17-15-28(24-33(32)45-3)40-42-31-16-12-25(2)19-30(31)41(44)43-40)52-39-36(48-6)22-27(23-37(39)49-7)14-13-26-20-34(46-4)38(50-8)35(21-26)47-5/h12-17,19-24,29,40,42H,9-11,18H2,1-8H3,(H,43,44)/b14-13- |
| InChIKey | OOMJENRIZBELMH-YPKPFQOOSA-N |
| XLogP | 8.09 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.84 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|