C17H17ClN2O4 — CID 94796382
(2R)-7-chloro-2-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 94796382) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is (2R)-7-chloro-2-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | (2R)-7-chloro-2-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 94796382 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2R)-7-chloro-2-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc([C@H]2NC(=O)c3ccc(Cl)cc3N2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17ClN2O4/c1-22-13-6-9(7-14(23-2)15(13)24-3)16-19-12-8-10(18)4-5-11(12)17(21)20-16/h4-8,16,19H,1-3H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | ACDCMDDRZIISME-MRXNPFEDSA-N |
| XLogP | 3.22 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |