C35H33ClN4O9 — CID 143999254
6-chloro-2-[3-methoxy-4-[[[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]phenoxy]amino]methoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 143999254) has the molecular formula C35H33ClN4O9 and a molecular weight of 689.12 g/mol. Its IUPAC name is 6-chloro-2-[3-methoxy-4-[[[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]phenoxy]amino]methoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 6-chloro-2-[3-methoxy-4-[[[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]phenoxy]amino]methoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 143999254 |
| Molecular Formula | C35H33ClN4O9 |
| Molecular Weight | 689.12 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | 6-chloro-2-[3-methoxy-4-[[[2-methoxy-5-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]phenoxy]amino]methoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc(C2NC(=O)c3cc(Cl)ccc3N2)ccc1OCNOc1cc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)on2)ccc1OC |
| InChI | InChI=1S/C35H33ClN4O9/c1-42-26-10-6-19(25-17-28(49-40-25)21-14-31(44-3)33(46-5)32(15-21)45-4)12-30(26)48-37-18-47-27-11-7-20(13-29(27)43-2)34-38-24-9-8-22(36)16-23(24)35(41)39-34/h6-17,34,37-38H,18H2,1-5H3,(H,39,41) |
| InChIKey | GHEPJSMGYNHFKA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 143.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.12 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|