C37H39N3O10 — CID 46207545
2-[4-[2-[2,6-dimethoxy-4-[5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]ethoxy]-3-methoxyphenyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 46207545) has the molecular formula C37H39N3O10 and a molecular weight of 685.73 g/mol. Its IUPAC name is 2-[4-[2-[2,6-dimethoxy-4-[5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]ethoxy]-3-methoxyphenyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[2-[2,6-dimethoxy-4-[5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]ethoxy]-3-methoxyphenyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 46207545 |
| Molecular Formula | C37H39N3O10 |
| Molecular Weight | 685.73 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | 2-[4-[2-[2,6-dimethoxy-4-[5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]ethoxy]-3-methoxyphenyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc(C2NC(=O)c3ccccc3N2)ccc1OCCOc1c(OC)cc(C2=NOC(c3cc(OC)c(OC)c(OC)c3)C2)cc1OC |
| InChI | InChI=1S/C37H39N3O10/c1-42-29-15-21(36-38-25-10-8-7-9-24(25)37(41)39-36)11-12-27(29)48-13-14-49-35-32(45-4)16-22(17-33(35)46-5)26-20-28(50-40-26)23-18-30(43-2)34(47-6)31(19-23)44-3/h7-12,15-19,28,36,38H,13-14,20H2,1-6H3,(H,39,41) |
| InChIKey | JFKDLZYFMGHINR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.73 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|