C38H41N3O10 — CID 89137612
2-[4-[2-[2,6-dimethoxy-4-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]ethoxy]-3-(hydroxymethyl)phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 89137612) has the molecular formula C38H41N3O10 and a molecular weight of 699.76 g/mol. Its IUPAC name is 2-[4-[2-[2,6-dimethoxy-4-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]ethoxy]-3-(hydroxymethyl)phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[2-[2,6-dimethoxy-4-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]ethoxy]-3-(hydroxymethyl)phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 89137612 |
| Molecular Formula | C38H41N3O10 |
| Molecular Weight | 699.76 g/mol |
| Exact Mass | 699.28 |
| IUPAC Name | 2-[4-[2-[2,6-dimethoxy-4-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]ethoxy]-3-(hydroxymethyl)phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc(C2=NOC(c3cc(CO)c(CO)c(CO)c3)C2)cc(OC)c1OCCOc1ccc(C2NC(=O)c3cc(C)ccc3N2)cc1CO |
| InChI | InChI=1S/C38H41N3O10/c1-21-4-6-30-28(10-21)38(46)40-37(39-30)22-5-7-32(27(11-22)19-44)49-8-9-50-36-34(47-2)14-23(15-35(36)48-3)31-16-33(51-41-31)24-12-25(17-42)29(20-45)26(13-24)18-43/h4-7,10-15,33,37,39,42-45H,8-9,16-20H2,1-3H3,(H,40,46) |
| InChIKey | CCOIOICTCJKYEL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 180.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|