C41H47N3O9 — CID 89137574
2-[3-(hydroxymethyl)-4-[6-[2-methoxy-5-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]hexoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 89137574) has the molecular formula C41H47N3O9 and a molecular weight of 725.84 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)-4-[6-[2-methoxy-5-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]hexoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[3-(hydroxymethyl)-4-[6-[2-methoxy-5-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]hexoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 89137574 |
| Molecular Formula | C41H47N3O9 |
| Molecular Weight | 725.84 g/mol |
| Exact Mass | 725.33 |
| IUPAC Name | 2-[3-(hydroxymethyl)-4-[6-[2-methoxy-5-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]hexoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1ccc(C2=NOC(c3cc(CO)c(CO)c(CO)c3)C2)cc1OCCCCCCOc1ccc(C2NC(=O)c3cc(C)ccc3N2)cc1CO |
| InChI | InChI=1S/C41H47N3O9/c1-25-7-10-34-32(15-25)41(49)43-40(42-34)27-9-11-36(31(16-27)23-47)51-13-5-3-4-6-14-52-39-19-26(8-12-37(39)50-2)35-20-38(53-44-35)28-17-29(21-45)33(24-48)30(18-28)22-46/h7-12,15-19,38,40,42,45-48H,3-6,13-14,20-24H2,1-2H3,(H,43,49) |
| InChIKey | FBAWNJNLJXELRB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 171.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.84 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|