C39H43N3O9 — CID 89137575
2-[3-(hydroxymethyl)-4-[4-[2-methoxy-5-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]butoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 89137575) has the molecular formula C39H43N3O9 and a molecular weight of 697.79 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)-4-[4-[2-methoxy-5-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]butoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[3-(hydroxymethyl)-4-[4-[2-methoxy-5-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]butoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 89137575 |
| Molecular Formula | C39H43N3O9 |
| Molecular Weight | 697.79 g/mol |
| Exact Mass | 697.30 |
| IUPAC Name | 2-[3-(hydroxymethyl)-4-[4-[2-methoxy-5-[5-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]butoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1ccc(C2=NOC(c3cc(CO)c(CO)c(CO)c3)C2)cc1OCCCCOc1ccc(C2NC(=O)c3cc(C)ccc3N2)cc1CO |
| InChI | InChI=1S/C39H43N3O9/c1-23-5-8-32-30(13-23)39(47)41-38(40-32)25-7-9-34(29(14-25)21-45)49-11-3-4-12-50-37-17-24(6-10-35(37)48-2)33-18-36(51-42-33)26-15-27(19-43)31(22-46)28(16-26)20-44/h5-10,13-17,36,38,40,43-46H,3-4,11-12,18-22H2,1-2H3,(H,41,47) |
| InChIKey | ULBVIFKPSGXKMS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 171.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|