C37H39N3O10 — CID 89137651
2-[3-(hydroxymethyl)-4-[2-[2-methoxy-5-[3-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]ethoxy]phenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 89137651) has the molecular formula C37H39N3O10 and a molecular weight of 685.73 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)-4-[2-[2-methoxy-5-[3-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]ethoxy]phenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[3-(hydroxymethyl)-4-[2-[2-methoxy-5-[3-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]ethoxy]phenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 89137651 |
| Molecular Formula | C37H39N3O10 |
| Molecular Weight | 685.73 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | 2-[3-(hydroxymethyl)-4-[2-[2-methoxy-5-[3-[3,4,5-tris(hydroxymethyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]ethoxy]phenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1ccc2c(c1)C(=O)NC(c1ccc(OCCOc3cc(C4CC(c5cc(CO)c(CO)c(CO)c5)=NO4)ccc3OC)c(CO)c1)N2 |
| InChI | InChI=1S/C37H39N3O10/c1-46-27-5-6-30-28(15-27)37(45)39-36(38-30)22-4-7-32(26(11-22)19-43)48-9-10-49-35-14-21(3-8-33(35)47-2)34-16-31(40-50-34)23-12-24(17-41)29(20-44)25(13-23)18-42/h3-8,11-15,34,36,38,41-44H,9-10,16-20H2,1-2H3,(H,39,45) |
| InChIKey | DJDFWVXCIVOHEQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 180.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.73 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|