C14H23NO2S — CID 123402128
1-(4-ethyl-3-methylcyclohexa-1,5-dien-1-yl)sulfonylpiperidine (PubChem CID 123402128) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-(4-ethyl-3-methylcyclohexa-1,5-dien-1-yl)sulfonylpiperidine.
| Compound Name | 1-(4-ethyl-3-methylcyclohexa-1,5-dien-1-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 123402128 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(4-ethyl-3-methylcyclohexa-1,5-dien-1-yl)sulfonylpiperidine |
| SMILES | CCC1C=CC(S(=O)(=O)N2CCCCC2)=CC1C |
| InChI | InChI=1S/C14H23NO2S/c1-3-13-7-8-14(11-12(13)2)18(16,17)15-9-5-4-6-10-15/h7-8,11-13H,3-6,9-10H2,1-2H3 |
| InChIKey | JSSFQXIIQYLLAS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |