C12H19NO2S — CID 141194739
1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylpiperidine (PubChem CID 141194739) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylpiperidine.
| Compound Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 141194739 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylpiperidine |
| SMILES | CC1(S(=O)(=O)N2CCCCC2)C=CC=CC1 |
| InChI | InChI=1S/C12H19NO2S/c1-12(8-4-2-5-9-12)16(14,15)13-10-6-3-7-11-13/h2,4-5,8H,3,6-7,9-11H2,1H3 |
| InChIKey | IZAJKEGDXJISLW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |