C13H25NO3S — CID 88537122
cyclohexene-1-sulfonate;1,1-dimethylpiperidin-1-ium (PubChem CID 88537122) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is cyclohexene-1-sulfonate;1,1-dimethylpiperidin-1-ium.
| Compound Name | cyclohexene-1-sulfonate;1,1-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 88537122 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | cyclohexene-1-sulfonate;1,1-dimethylpiperidin-1-ium |
| SMILES | C[N+]1(C)CCCCC1.O=S(=O)([O-])C1=CCCCC1 |
| InChI | InChI=1S/C7H16N.C6H10O3S/c1-8(2)6-4-3-5-7-8;7-10(8,9)6-4-2-1-3-5-6/h3-7H2,1-2H3;4H,1-3,5H2,(H,7,8,9)/q+1;/p-1 |
| InChIKey | QXPPXRBCTCMAPX-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|