C19H39NO3S — CID 88537193
cyclohexene-1-sulfonate;tributyl(methyl)azanium (PubChem CID 88537193) has the molecular formula C19H39NO3S and a molecular weight of 361.59 g/mol. Its IUPAC name is cyclohexene-1-sulfonate;tributyl(methyl)azanium.
| Compound Name | cyclohexene-1-sulfonate;tributyl(methyl)azanium |
|---|---|
| PubChem CID | 88537193 |
| Molecular Formula | C19H39NO3S |
| Molecular Weight | 361.59 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | cyclohexene-1-sulfonate;tributyl(methyl)azanium |
| SMILES | CCCC[N+](C)(CCCC)CCCC.O=S(=O)([O-])C1=CCCCC1 |
| InChI | InChI=1S/C13H30N.C6H10O3S/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;7-10(8,9)6-4-2-1-3-5-6/h5-13H2,1-4H3;4H,1-3,5H2,(H,7,8,9)/q+1;/p-1 |
| InChIKey | CWPWIFQNVJPZSL-UHFFFAOYSA-M |
| XLogP | 4.82 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|