C9H13N3O2S — CID 123407010
6-amino-5-methyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)pyridine-3-carboxamide (PubChem CID 123407010) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 6-amino-5-methyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)pyridine-3-carboxamide.
| Compound Name | 6-amino-5-methyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123407010 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 6-amino-5-methyl-N-(methyl-methylidene-oxo-λ6-sulfanyl)pyridine-3-carboxamide |
| SMILES | C=S(C)(=O)NC(=O)c1cnc(N)c(C)c1 |
| InChI | InChI=1S/C9H13N3O2S/c1-6-4-7(5-11-8(6)10)9(13)12-15(2,3)14/h4-5H,2H2,1,3H3,(H2,10,11)(H,12,13,14) |
| InChIKey | SDIKAHFCXGTGAP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|