C13H20N+ — CID 123407869
2-methyl-3-penta-1,3-dienyl-1-pent-1-enyl-2H-azirin-1-ium (PubChem CID 123407869) has the molecular formula C13H20N+ and a molecular weight of 190.31 g/mol. Its IUPAC name is 2-methyl-3-penta-1,3-dienyl-1-pent-1-enyl-2H-azirin-1-ium.
| Compound Name | 2-methyl-3-penta-1,3-dienyl-1-pent-1-enyl-2H-azirin-1-ium |
|---|---|
| PubChem CID | 123407869 |
| Molecular Formula | C13H20N+ |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 2-methyl-3-penta-1,3-dienyl-1-pent-1-enyl-2H-azirin-1-ium |
| SMILES | CC=CC=CC1=[N+](C=CCCC)C1C |
| InChI | InChI=1S/C13H20N/c1-4-6-8-10-13-12(3)14(13)11-9-7-5-2/h4,6,8-12H,5,7H2,1-3H3/q+1 |
| InChIKey | DAOYARURLJIQSN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|