C31H33FN4O5 — CID 123411083
ethyl 4-[2-[(3-fluorobenzoyl)amino]-6-(2-phenylmethoxyethoxy)imidazo[4,5-c]pyridin-1-yl]cyclohexane-1-carboxylate (PubChem CID 123411083) has the molecular formula C31H33FN4O5 and a molecular weight of 560.63 g/mol. Its IUPAC name is ethyl 4-[2-[(3-fluorobenzoyl)amino]-6-(2-phenylmethoxyethoxy)imidazo[4,5-c]pyridin-1-yl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[2-[(3-fluorobenzoyl)amino]-6-(2-phenylmethoxyethoxy)imidazo[4,5-c]pyridin-1-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123411083 |
| Molecular Formula | C31H33FN4O5 |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | ethyl 4-[2-[(3-fluorobenzoyl)amino]-6-(2-phenylmethoxyethoxy)imidazo[4,5-c]pyridin-1-yl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(n2c(NC(=O)c3cccc(F)c3)nc3cnc(OCCOCc4ccccc4)cc32)CC1 |
| InChI | InChI=1S/C31H33FN4O5/c1-2-40-30(38)22-11-13-25(14-12-22)36-27-18-28(41-16-15-39-20-21-7-4-3-5-8-21)33-19-26(27)34-31(36)35-29(37)23-9-6-10-24(32)17-23/h3-10,17-19,22,25H,2,11-16,20H2,1H3,(H,34,35,37) |
| InChIKey | CGJYSWKFGRPQKP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|