C29H31N3O2 — CID 123411124
1-(3-aminophenyl)-4-[3,3-dimethyl-5-(2-phenylethyl)-2H-indole-1-carbonyl]pyrrolidin-2-one (PubChem CID 123411124) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 1-(3-aminophenyl)-4-[3,3-dimethyl-5-(2-phenylethyl)-2H-indole-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3-aminophenyl)-4-[3,3-dimethyl-5-(2-phenylethyl)-2H-indole-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123411124 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-(3-aminophenyl)-4-[3,3-dimethyl-5-(2-phenylethyl)-2H-indole-1-carbonyl]pyrrolidin-2-one |
| SMILES | CC1(C)CN(C(=O)C2CC(=O)N(c3cccc(N)c3)C2)c2ccc(CCc3ccccc3)cc21 |
| InChI | InChI=1S/C29H31N3O2/c1-29(2)19-32(26-14-13-21(15-25(26)29)12-11-20-7-4-3-5-8-20)28(34)22-16-27(33)31(18-22)24-10-6-9-23(30)17-24/h3-10,13-15,17,22H,11-12,16,18-19,30H2,1-2H3 |
| InChIKey | YRVACINTTWNXEY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|