C26H27N5O2 — CID 123969055
1-(3-aminophenyl)-4-[3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydroindole-1-carbonyl]pyrrolidin-2-one (PubChem CID 123969055) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 1-(3-aminophenyl)-4-[3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydroindole-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3-aminophenyl)-4-[3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydroindole-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123969055 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-(3-aminophenyl)-4-[3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydroindole-1-carbonyl]pyrrolidin-2-one |
| SMILES | CC1CN(C(=O)C2CC(=O)N(c3cccc(N)c3)C2)c2ccc(CCc3cncnc3)cc21 |
| InChI | InChI=1S/C26H27N5O2/c1-17-14-31(24-8-7-18(9-23(17)24)5-6-19-12-28-16-29-13-19)26(33)20-10-25(32)30(15-20)22-4-2-3-21(27)11-22/h2-4,7-9,11-13,16-17,20H,5-6,10,14-15,27H2,1H3 |
| InChIKey | AEUBKXYFQRVIEJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|