C26H28ClN5O2 — CID 144619835
(4S)-1-(3-aminophenyl)-4-[6-chloro-5-(2-imidazol-1-ylethyl)-3,3-dimethyl-2H-indole-1-carbonyl]pyrrolidin-2-one (PubChem CID 144619835) has the molecular formula C26H28ClN5O2 and a molecular weight of 478.00 g/mol. Its IUPAC name is (4S)-1-(3-aminophenyl)-4-[6-chloro-5-(2-imidazol-1-ylethyl)-3,3-dimethyl-2H-indole-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4S)-1-(3-aminophenyl)-4-[6-chloro-5-(2-imidazol-1-ylethyl)-3,3-dimethyl-2H-indole-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 144619835 |
| Molecular Formula | C26H28ClN5O2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (4S)-1-(3-aminophenyl)-4-[6-chloro-5-(2-imidazol-1-ylethyl)-3,3-dimethyl-2H-indole-1-carbonyl]pyrrolidin-2-one |
| SMILES | CC1(C)CN(C(=O)[C@H]2CC(=O)N(c3cccc(N)c3)C2)c2cc(Cl)c(CCn3ccnc3)cc21 |
| InChI | InChI=1S/C26H28ClN5O2/c1-26(2)15-32(23-13-22(27)17(10-21(23)26)6-8-30-9-7-29-16-30)25(34)18-11-24(33)31(14-18)20-5-3-4-19(28)12-20/h3-5,7,9-10,12-13,16,18H,6,8,11,14-15,28H2,1-2H3/t18-/m0/s1 |
| InChIKey | ZKKIZMHWQGABOC-SFHVURJKSA-N |
| XLogP | 4.04 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|