C27H28N4O2 — CID 123777089
1-(3-aminophenyl)-4-[3,3-dimethyl-5-(pyridin-4-ylmethyl)-2H-indole-1-carbonyl]pyrrolidin-2-one (PubChem CID 123777089) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 1-(3-aminophenyl)-4-[3,3-dimethyl-5-(pyridin-4-ylmethyl)-2H-indole-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3-aminophenyl)-4-[3,3-dimethyl-5-(pyridin-4-ylmethyl)-2H-indole-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123777089 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 1-(3-aminophenyl)-4-[3,3-dimethyl-5-(pyridin-4-ylmethyl)-2H-indole-1-carbonyl]pyrrolidin-2-one |
| SMILES | CC1(C)CN(C(=O)C2CC(=O)N(c3cccc(N)c3)C2)c2ccc(Cc3ccncc3)cc21 |
| InChI | InChI=1S/C27H28N4O2/c1-27(2)17-31(24-7-6-19(13-23(24)27)12-18-8-10-29-11-9-18)26(33)20-14-25(32)30(16-20)22-5-3-4-21(28)15-22/h3-11,13,15,20H,12,14,16-17,28H2,1-2H3 |
| InChIKey | HGBCBDCNFQZZHF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|