C11H17N6O13P3 — CID 123411463
[[5-[8-amino-6-(methylideneamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123411463) has the molecular formula C11H17N6O13P3 and a molecular weight of 534.21 g/mol. Its IUPAC name is [[5-[8-amino-6-(methylideneamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-[8-amino-6-(methylideneamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123411463 |
| Molecular Formula | C11H17N6O13P3 |
| Molecular Weight | 534.21 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | [[5-[8-amino-6-(methylideneamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=Nc1ncnc2c1nc(N)n2C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C11H17N6O13P3/c1-13-8-5-9(15-3-14-8)17(11(12)16-5)10-7(19)6(18)4(28-10)2-27-32(23,24)30-33(25,26)29-31(20,21)22/h3-4,6-7,10,18-19H,1-2H2,(H2,12,16)(H,23,24)(H,25,26)(H2,20,21,22) |
| InChIKey | QJGMHFFSSFPUDW-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 291.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.21 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|