C20H18F3N7O2S — CID 123412257
N-[[2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydro-1H-[1]benzoxepino[5,4-d][1,2]thiazol-8-yl]methyl]-1H-pyrazole-4-carboxamide (PubChem CID 123412257) has the molecular formula C20H18F3N7O2S and a molecular weight of 477.47 g/mol. Its IUPAC name is N-[[2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydro-1H-[1]benzoxepino[5,4-d][1,2]thiazol-8-yl]methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[[2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydro-1H-[1]benzoxepino[5,4-d][1,2]thiazol-8-yl]methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123412257 |
| Molecular Formula | C20H18F3N7O2S |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-[[2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydro-1H-[1]benzoxepino[5,4-d][1,2]thiazol-8-yl]methyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCCC1=C2CN(c2ncnn2CC(F)(F)F)S1)c1cn[nH]c1 |
| InChI | InChI=1S/C20H18F3N7O2S/c21-20(22,23)10-29-19(25-11-28-29)30-9-15-14-2-1-12(5-16(14)32-4-3-17(15)33-30)6-24-18(31)13-7-26-27-8-13/h1-2,5,7-8,11H,3-4,6,9-10H2,(H,24,31)(H,26,27) |
| InChIKey | FAWIBJABXUGQRB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|