C22H25N3O2 — CID 123413528
3-[5-(2-aminopropyl)-7-cyano-2,3-dihydro-1H-indol-3-yl]propyl benzoate (PubChem CID 123413528) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-[5-(2-aminopropyl)-7-cyano-2,3-dihydro-1H-indol-3-yl]propyl benzoate.
| Compound Name | 3-[5-(2-aminopropyl)-7-cyano-2,3-dihydro-1H-indol-3-yl]propyl benzoate |
|---|---|
| PubChem CID | 123413528 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-[5-(2-aminopropyl)-7-cyano-2,3-dihydro-1H-indol-3-yl]propyl benzoate |
| SMILES | CC(N)Cc1cc(C#N)c2c(c1)C(CCCOC(=O)c1ccccc1)CN2 |
| InChI | InChI=1S/C22H25N3O2/c1-15(24)10-16-11-19(13-23)21-20(12-16)18(14-25-21)8-5-9-27-22(26)17-6-3-2-4-7-17/h2-4,6-7,11-12,15,18,25H,5,8-10,14,24H2,1H3 |
| InChIKey | JZEGMPMSGAWGCU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|