C25H36N2O — CID 123417357
1-(2-butyl-3-phenyl-3,4-dihydropyrazol-5-yl)-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone (PubChem CID 123417357) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is 1-(2-butyl-3-phenyl-3,4-dihydropyrazol-5-yl)-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone.
| Compound Name | 1-(2-butyl-3-phenyl-3,4-dihydropyrazol-5-yl)-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
|---|---|
| PubChem CID | 123417357 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 1-(2-butyl-3-phenyl-3,4-dihydropyrazol-5-yl)-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
| SMILES | CCCCN1N=C(C(=O)C[C@H]2C[C@H]3CC[C@]2(C)C3(C)C)CC1c1ccccc1 |
| InChI | InChI=1S/C25H36N2O/c1-5-6-14-27-22(18-10-8-7-9-11-18)17-21(26-27)23(28)16-20-15-19-12-13-25(20,4)24(19,2)3/h7-11,19-20,22H,5-6,12-17H2,1-4H3/t19-,20-,22?,25+/m1/s1 |
| InChIKey | QLTOOZNNBZDBPE-CNAYRYARSA-N |
| XLogP | 6.01 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |