C26H37FN2O — CID 58330439
1-[3-(4-fluorophenyl)-2-pentyl-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone (PubChem CID 58330439) has the molecular formula C26H37FN2O and a molecular weight of 412.59 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)-2-pentyl-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone.
| Compound Name | 1-[3-(4-fluorophenyl)-2-pentyl-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
|---|---|
| PubChem CID | 58330439 |
| Molecular Formula | C26H37FN2O |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | 1-[3-(4-fluorophenyl)-2-pentyl-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
| SMILES | CCCCCN1N=C(C(=O)C[C@H]2C[C@@H]3CC[C@]2(C)C3(C)C)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H37FN2O/c1-5-6-7-14-29-23(18-8-10-21(27)11-9-18)17-22(28-29)24(30)16-20-15-19-12-13-26(20,4)25(19,2)3/h8-11,19-20,23H,5-7,12-17H2,1-4H3/t19-,20+,23?,26-/m0/s1 |
| InChIKey | WXCKPCAZYRUJBI-WHPUTTHLSA-N |
| XLogP | 6.54 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|