C18H24O2 — CID 22730795
methyl 4-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoate (PubChem CID 22730795) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is methyl 4-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoate.
| Compound Name | methyl 4-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoate |
|---|---|
| PubChem CID | 22730795 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | methyl 4-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoate |
| SMILES | COC(=O)c1ccc(C2CC3CCC2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C18H24O2/c1-17(2)14-9-10-18(17,3)15(11-14)12-5-7-13(8-6-12)16(19)20-4/h5-8,14-15H,9-11H2,1-4H3 |
| InChIKey | LBDKCWZPFFJHGS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |