C24H35N5O — CID 123421903
3-[4-[(3-aminopropylamino)methyl]phenyl]-6-(2-cyclohexylethyl)-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 123421903) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is 3-[4-[(3-aminopropylamino)methyl]phenyl]-6-(2-cyclohexylethyl)-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | 3-[4-[(3-aminopropylamino)methyl]phenyl]-6-(2-cyclohexylethyl)-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 123421903 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 3-[4-[(3-aminopropylamino)methyl]phenyl]-6-(2-cyclohexylethyl)-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | NCCCNCc1ccc(N2C=C3C=C(CCC4CCCCC4)NC3NC2=O)cc1 |
| InChI | InChI=1S/C24H35N5O/c25-13-4-14-26-16-19-8-11-22(12-9-19)29-17-20-15-21(27-23(20)28-24(29)30)10-7-18-5-2-1-3-6-18/h8-9,11-12,15,17-18,23,26-27H,1-7,10,13-14,16,25H2,(H,28,30) |
| InChIKey | KKCNRKPRPJAUDP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|