C19H25N7OS2 — CID 123601940
2-[3-[[4-[6-(1,3-dithietan-2-yl)-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 123601940) has the molecular formula C19H25N7OS2 and a molecular weight of 431.59 g/mol. Its IUPAC name is 2-[3-[[4-[6-(1,3-dithietan-2-yl)-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-(1,3-dithietan-2-yl)-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 123601940 |
| Molecular Formula | C19H25N7OS2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-[3-[[4-[6-(1,3-dithietan-2-yl)-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(N2C=C3C=C(C4SCS4)NC3NC2=O)cc1 |
| InChI | InChI=1S/C19H25N7OS2/c20-18(21)23-7-1-6-22-9-12-2-4-14(5-3-12)26-10-13-8-15(17-28-11-29-17)24-16(13)25-19(26)27/h2-5,8,10,16-17,22,24H,1,6-7,9,11H2,(H,25,27)(H4,20,21,23) |
| InChIKey | SFTZNQZVORMNCU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|