C30H43N9O — CID 123290143
2-[3-[[(1S)-1-[4-[6-[4-[(4S)-4-aminopentyl]-6-ethyl-2-pyridinyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine (PubChem CID 123290143) has the molecular formula C30H43N9O and a molecular weight of 545.74 g/mol. Its IUPAC name is 2-[3-[[(1S)-1-[4-[6-[4-[(4S)-4-aminopentyl]-6-ethyl-2-pyridinyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(1S)-1-[4-[6-[4-[(4S)-4-aminopentyl]-6-ethyl-2-pyridinyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 123290143 |
| Molecular Formula | C30H43N9O |
| Molecular Weight | 545.74 g/mol |
| Exact Mass | 545.36 |
| IUPAC Name | 2-[3-[[(1S)-1-[4-[6-[4-[(4S)-4-aminopentyl]-6-ethyl-2-pyridinyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
| SMILES | CCc1cc(CCC[C@H](C)N)cc(C2=CC3=CN(c4ccc([C@H](C)NCCCN=C(N)N)cc4)C(=O)NC3N2)n1 |
| InChI | InChI=1S/C30H43N9O/c1-4-24-15-21(8-5-7-19(2)31)16-26(36-24)27-17-23-18-39(30(40)38-28(23)37-27)25-11-9-22(10-12-25)20(3)34-13-6-14-35-29(32)33/h9-12,15-20,28,34,37H,4-8,13-14,31H2,1-3H3,(H,38,40)(H4,32,33,35)/t19-,20-,28?/m0/s1 |
| InChIKey | QBJJWEMMZHCSQM-NUGJNUBVSA-N |
| XLogP | 3.01 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.74 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|