C20H27N7O3 — CID 123285686
3-[3-(diaminomethylideneamino)propylamino]-3-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]propanoic acid (PubChem CID 123285686) has the molecular formula C20H27N7O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-[3-(diaminomethylideneamino)propylamino]-3-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]propanoic acid.
| Compound Name | 3-[3-(diaminomethylideneamino)propylamino]-3-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 123285686 |
| Molecular Formula | C20H27N7O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 3-[3-(diaminomethylideneamino)propylamino]-3-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]propanoic acid |
| SMILES | CC1=CC2=CN(c3ccc(C(CC(=O)O)NCCCN=C(N)N)cc3)C(=O)NC2N1 |
| InChI | InChI=1S/C20H27N7O3/c1-12-9-14-11-27(20(30)26-18(14)25-12)15-5-3-13(4-6-15)16(10-17(28)29)23-7-2-8-24-19(21)22/h3-6,9,11,16,18,23,25H,2,7-8,10H2,1H3,(H,26,30)(H,28,29)(H4,21,22,24) |
| InChIKey | LQACGRSUNFUTOP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 158.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|