C19H24F3N7O — CID 123630969
2-[3-[[2,2,2-trifluoro-1-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]ethyl]amino]propyl]guanidine (PubChem CID 123630969) has the molecular formula C19H24F3N7O and a molecular weight of 423.44 g/mol. Its IUPAC name is 2-[3-[[2,2,2-trifluoro-1-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]ethyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[2,2,2-trifluoro-1-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]ethyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 123630969 |
| Molecular Formula | C19H24F3N7O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[3-[[2,2,2-trifluoro-1-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]ethyl]amino]propyl]guanidine |
| SMILES | CC1=CC2=CN(c3ccc(C(NCCCN=C(N)N)C(F)(F)F)cc3)C(=O)NC2N1 |
| InChI | InChI=1S/C19H24F3N7O/c1-11-9-13-10-29(18(30)28-16(13)27-11)14-5-3-12(4-6-14)15(19(20,21)22)25-7-2-8-26-17(23)24/h3-6,9-10,15-16,25,27H,2,7-8H2,1H3,(H,28,30)(H4,23,24,26) |
| InChIKey | ZISRDNJNOMZPLP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|