C22H32N8O3 — CID 123957096
2-[3-[[4-[6-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 123957096) has the molecular formula C22H32N8O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[3-[[4-[6-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 123957096 |
| Molecular Formula | C22H32N8O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-[3-[[4-[6-[4-amino-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(N2C=C3C=C(C4CC(N)C(CO)O4)NC3NC2=O)cc1 |
| InChI | InChI=1S/C22H32N8O3/c23-16-9-18(33-19(16)12-31)17-8-14-11-30(22(32)29-20(14)28-17)15-4-2-13(3-5-15)10-26-6-1-7-27-21(24)25/h2-5,8,11,16,18-20,26,28,31H,1,6-7,9-10,12,23H2,(H,29,32)(H4,24,25,27) |
| InChIKey | NQLNCNOOAUIRRJ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 176.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|