C26H40N10O — CID 123618291
4-[3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-yl]piperidin-1-yl]butanimidamide (PubChem CID 123618291) has the molecular formula C26H40N10O and a molecular weight of 508.68 g/mol. Its IUPAC name is 4-[3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-yl]piperidin-1-yl]butanimidamide.
| Compound Name | 4-[3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-yl]piperidin-1-yl]butanimidamide |
|---|---|
| PubChem CID | 123618291 |
| Molecular Formula | C26H40N10O |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | 4-[3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-yl]piperidin-1-yl]butanimidamide |
| SMILES | [H]/N=C(\N)CCCN1CCCC(C2=CC3=CN(c4ccc(CNCCCN=C(N)N)cc4)C(=O)NC3N2)C1 |
| InChI | InChI=1S/C26H40N10O/c27-23(28)5-2-13-35-12-1-4-19(16-35)22-14-20-17-36(26(37)34-24(20)33-22)21-8-6-18(7-9-21)15-31-10-3-11-32-25(29)30/h6-9,14,17,19,24,31,33H,1-5,10-13,15-16H2,(H3,27,28)(H,34,37)(H4,29,30,32) |
| InChIKey | SHBCYVCYKOAQCZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 173.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|