C20H27N7OS — CID 123499820
2-[3-[1-[4-(6-methylsulfanyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]prop-2-enylamino]propyl]guanidine (PubChem CID 123499820) has the molecular formula C20H27N7OS and a molecular weight of 413.55 g/mol. Its IUPAC name is 2-[3-[1-[4-(6-methylsulfanyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]prop-2-enylamino]propyl]guanidine.
| Compound Name | 2-[3-[1-[4-(6-methylsulfanyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]prop-2-enylamino]propyl]guanidine |
|---|---|
| PubChem CID | 123499820 |
| Molecular Formula | C20H27N7OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[3-[1-[4-(6-methylsulfanyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]prop-2-enylamino]propyl]guanidine |
| SMILES | C=CC(NCCCN=C(N)N)c1ccc(N2C=C3C=C(SC)NC3NC2=O)cc1 |
| InChI | InChI=1S/C20H27N7OS/c1-3-16(23-9-4-10-24-19(21)22)13-5-7-15(8-6-13)27-12-14-11-17(29-2)25-18(14)26-20(27)28/h3,5-8,11-12,16,18,23,25H,1,4,9-10H2,2H3,(H,26,28)(H4,21,22,24) |
| InChIKey | ARYQZGUBQUYIID-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|