C12H19FN4 — CID 66580256
2-[3-[[fluoro-(4-methylphenyl)methyl]amino]propyl]guanidine (PubChem CID 66580256) has the molecular formula C12H19FN4 and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-[3-[[fluoro-(4-methylphenyl)methyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[fluoro-(4-methylphenyl)methyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 66580256 |
| Molecular Formula | C12H19FN4 |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-[3-[[fluoro-(4-methylphenyl)methyl]amino]propyl]guanidine |
| SMILES | Cc1ccc(C(F)NCCCN=C(N)N)cc1 |
| InChI | InChI=1S/C12H19FN4/c1-9-3-5-10(6-4-9)11(13)16-7-2-8-17-12(14)15/h3-6,11,16H,2,7-8H2,1H3,(H4,14,15,17) |
| InChIKey | IBPDVSRNAIWDFW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|