C31H44N10O3S — CID 123958815
2-[3-[3-aminopropyl-[[4-[2-oxo-6-[4-(piperidin-4-ylsulfamoyl)phenyl]-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine (PubChem CID 123958815) has the molecular formula C31H44N10O3S and a molecular weight of 636.83 g/mol. Its IUPAC name is 2-[3-[3-aminopropyl-[[4-[2-oxo-6-[4-(piperidin-4-ylsulfamoyl)phenyl]-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[3-aminopropyl-[[4-[2-oxo-6-[4-(piperidin-4-ylsulfamoyl)phenyl]-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 123958815 |
| Molecular Formula | C31H44N10O3S |
| Molecular Weight | 636.83 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | 2-[3-[3-aminopropyl-[[4-[2-oxo-6-[4-(piperidin-4-ylsulfamoyl)phenyl]-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methyl]amino]propyl]guanidine |
| SMILES | NCCCN(CCCN=C(N)N)Cc1ccc(N2C=C3C=C(c4ccc(S(=O)(=O)NC5CCNCC5)cc4)NC3NC2=O)cc1 |
| InChI | InChI=1S/C31H44N10O3S/c32-13-1-17-40(18-2-14-36-30(33)34)20-22-3-7-26(8-4-22)41-21-24-19-28(37-29(24)38-31(41)42)23-5-9-27(10-6-23)45(43,44)39-25-11-15-35-16-12-25/h3-10,19,21,25,29,35,37,39H,1-2,11-18,20,32H2,(H,38,42)(H4,33,34,36) |
| InChIKey | XCEHJRYKCMAHDI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 196.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.83 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|