C18H25N7OS — CID 123488700
2-[3-[1-[4-(2-oxo-6-sulfanyl-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]ethylamino]propyl]guanidine (PubChem CID 123488700) has the molecular formula C18H25N7OS and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-[3-[1-[4-(2-oxo-6-sulfanyl-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]ethylamino]propyl]guanidine.
| Compound Name | 2-[3-[1-[4-(2-oxo-6-sulfanyl-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]ethylamino]propyl]guanidine |
|---|---|
| PubChem CID | 123488700 |
| Molecular Formula | C18H25N7OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[3-[1-[4-(2-oxo-6-sulfanyl-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]ethylamino]propyl]guanidine |
| SMILES | CC(NCCCN=C(N)N)c1ccc(N2C=C3C=C(S)NC3NC2=O)cc1 |
| InChI | InChI=1S/C18H25N7OS/c1-11(21-7-2-8-22-17(19)20)12-3-5-14(6-4-12)25-10-13-9-15(27)23-16(13)24-18(25)26/h3-6,9-11,16,21,23,27H,2,7-8H2,1H3,(H,24,26)(H4,19,20,22) |
| InChIKey | KJXBUNWSLTZTEL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|