C33H43N11O3S — CID 123269562
2-[3-[[4-[6-[3-[2-imidazol-1-ylethyl(piperidin-4-yl)sulfamoyl]phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 123269562) has the molecular formula C33H43N11O3S and a molecular weight of 673.85 g/mol. Its IUPAC name is 2-[3-[[4-[6-[3-[2-imidazol-1-ylethyl(piperidin-4-yl)sulfamoyl]phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[3-[2-imidazol-1-ylethyl(piperidin-4-yl)sulfamoyl]phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 123269562 |
| Molecular Formula | C33H43N11O3S |
| Molecular Weight | 673.85 g/mol |
| Exact Mass | 673.33 |
| IUPAC Name | 2-[3-[[4-[6-[3-[2-imidazol-1-ylethyl(piperidin-4-yl)sulfamoyl]phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(N2C=C3C=C(c4cccc(S(=O)(=O)N(CCn5ccnc5)C5CCNCC5)c4)NC3NC2=O)cc1 |
| InChI | InChI=1S/C33H43N11O3S/c34-32(35)39-12-2-11-37-21-24-5-7-27(8-6-24)43-22-26-20-30(40-31(26)41-33(43)45)25-3-1-4-29(19-25)48(46,47)44(28-9-13-36-14-10-28)18-17-42-16-15-38-23-42/h1,3-8,15-16,19-20,22-23,28,31,36-37,40H,2,9-14,17-18,21H2,(H,41,45)(H4,34,35,39) |
| InChIKey | UWPRQMQNFMJLCU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 188.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.85 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|