C29H36ClFN8O — CID 122428238
2-[3-[[(1S)-1-[4-[4-amino-5-[2-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]ethynyl]-2-oxopyrimidin-1-yl]phenyl]ethyl]amino]propyl]guanidine (PubChem CID 122428238) has the molecular formula C29H36ClFN8O and a molecular weight of 567.11 g/mol. Its IUPAC name is 2-[3-[[(1S)-1-[4-[4-amino-5-[2-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]ethynyl]-2-oxopyrimidin-1-yl]phenyl]ethyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(1S)-1-[4-[4-amino-5-[2-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]ethynyl]-2-oxopyrimidin-1-yl]phenyl]ethyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 122428238 |
| Molecular Formula | C29H36ClFN8O |
| Molecular Weight | 567.11 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 2-[3-[[(1S)-1-[4-[4-amino-5-[2-[5-[(4S)-4-aminopentyl]-3-chloro-2-fluorophenyl]ethynyl]-2-oxopyrimidin-1-yl]phenyl]ethyl]amino]propyl]guanidine |
| SMILES | C[C@H](N)CCCc1cc(Cl)c(F)c(C#Cc2cn(-c3ccc([C@H](C)NCCCN=C(N)N)cc3)c(=O)nc2N)c1 |
| InChI | InChI=1S/C29H36ClFN8O/c1-18(32)5-3-6-20-15-22(26(31)25(30)16-20)7-8-23-17-39(29(40)38-27(23)33)24-11-9-21(10-12-24)19(2)36-13-4-14-37-28(34)35/h9-12,15-19,36H,3-6,13-14,32H2,1-2H3,(H2,33,38,40)(H4,34,35,37)/t18-,19-/m0/s1 |
| InChIKey | KEOIGRMSGAHWCU-OALUTQOASA-N |
| XLogP | 2.99 |
| TPSA | 163.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|