C8H8BrN3 — CID 123425732
2-bromo-1-pyridin-2-ylpropane-1,3-diimine (PubChem CID 123425732) has the molecular formula C8H8BrN3 and a molecular weight of 226.08 g/mol. Its IUPAC name is 2-bromo-1-pyridin-2-ylpropane-1,3-diimine.
| Compound Name | 2-bromo-1-pyridin-2-ylpropane-1,3-diimine |
|---|---|
| PubChem CID | 123425732 |
| Molecular Formula | C8H8BrN3 |
| Molecular Weight | 226.08 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 2-bromo-1-pyridin-2-ylpropane-1,3-diimine |
| SMILES | [H]/N=C(/c1ccccn1)C(Br)/C=N/[H] |
| InChI | InChI=1S/C8H8BrN3/c9-6(5-10)8(11)7-3-1-2-4-12-7/h1-6,10-11H/b10-5+,11-8+ |
| InChIKey | TVVZTXYPCMDYSP-TVNUJMIRSA-N |
| XLogP | 1.86 |
| TPSA | 60.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.08 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|