C13H21NO3 — CID 123425899
tert-butyl 5-formyl-4-propan-2-yl-2,3-dihydropyrrole-1-carboxylate (PubChem CID 123425899) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl 5-formyl-4-propan-2-yl-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-formyl-4-propan-2-yl-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 123425899 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl 5-formyl-4-propan-2-yl-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)C1=C(C=O)N(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H21NO3/c1-9(2)10-6-7-14(11(10)8-15)12(16)17-13(3,4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | UKHZMEMLUZFGMQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|