C17H23NO4S — CID 123426633
cis-(1R,2S)-1-[3-(phenylmethoxycarbonylamino)propyl]-2-sulfanylcyclopentane-1-carboxylic acid (PubChem CID 123426633) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is cis-(1R,2S)-1-[3-(phenylmethoxycarbonylamino)propyl]-2-sulfanylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-1-[3-(phenylmethoxycarbonylamino)propyl]-2-sulfanylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 123426633 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | cis-(1R,2S)-1-[3-(phenylmethoxycarbonylamino)propyl]-2-sulfanylcyclopentane-1-carboxylic acid |
| SMILES | O=C(NCCC[C@@]1(C(=O)O)CCC[C@@H]1S)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4S/c19-15(20)17(9-4-8-14(17)23)10-5-11-18-16(21)22-12-13-6-2-1-3-7-13/h1-3,6-7,14,23H,4-5,8-12H2,(H,18,21)(H,19,20)/t14-,17-/m0/s1 |
| InChIKey | DBQCPGTXTDOYHW-YOEHRIQHSA-N |
| XLogP | 3.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|