C26H31NO5S — CID 87574669
benzyl 2-acetylsulfanyl-1-[3-(phenylmethoxycarbonylamino)propyl]cyclopentane-1-carboxylate (PubChem CID 87574669) has the molecular formula C26H31NO5S and a molecular weight of 469.60 g/mol. Its IUPAC name is benzyl 2-acetylsulfanyl-1-[3-(phenylmethoxycarbonylamino)propyl]cyclopentane-1-carboxylate.
| Compound Name | benzyl 2-acetylsulfanyl-1-[3-(phenylmethoxycarbonylamino)propyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 87574669 |
| Molecular Formula | C26H31NO5S |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | benzyl 2-acetylsulfanyl-1-[3-(phenylmethoxycarbonylamino)propyl]cyclopentane-1-carboxylate |
| SMILES | CC(=O)SC1CCCC1(CCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H31NO5S/c1-20(28)33-23-14-8-15-26(23,24(29)31-18-21-10-4-2-5-11-21)16-9-17-27-25(30)32-19-22-12-6-3-7-13-22/h2-7,10-13,23H,8-9,14-19H2,1H3,(H,27,30) |
| InChIKey | YAOKJIUBXJSQAX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|