C18H25NO7S — CID 87196310
2-methylsulfonyloxy-1-[3-(phenylmethoxycarbonylamino)propyl]cyclopentane-1-carboxylic acid (PubChem CID 87196310) has the molecular formula C18H25NO7S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-methylsulfonyloxy-1-[3-(phenylmethoxycarbonylamino)propyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-methylsulfonyloxy-1-[3-(phenylmethoxycarbonylamino)propyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 87196310 |
| Molecular Formula | C18H25NO7S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-methylsulfonyloxy-1-[3-(phenylmethoxycarbonylamino)propyl]cyclopentane-1-carboxylic acid |
| SMILES | CS(=O)(=O)OC1CCCC1(CCCNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H25NO7S/c1-27(23,24)26-15-9-5-10-18(15,16(20)21)11-6-12-19-17(22)25-13-14-7-3-2-4-8-14/h2-4,7-8,15H,5-6,9-13H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | BRBWQHZSESQKBD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|