C15H20N2O4S — CID 13336145
S-[2-[3-(phenylmethoxycarbonylamino)propanoylamino]ethyl] ethanethioate (PubChem CID 13336145) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is S-[2-[3-(phenylmethoxycarbonylamino)propanoylamino]ethyl] ethanethioate.
| Compound Name | S-[2-[3-(phenylmethoxycarbonylamino)propanoylamino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 13336145 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | S-[2-[3-(phenylmethoxycarbonylamino)propanoylamino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O4S/c1-12(18)22-10-9-16-14(19)7-8-17-15(20)21-11-13-5-3-2-4-6-13/h2-6H,7-11H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | SNNPQFKMSJZDES-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|