C30H23N3O4S — CID 123430375
4-[3-(1H-indol-5-yl)-4-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-methoxybenzaldehyde (PubChem CID 123430375) has the molecular formula C30H23N3O4S and a molecular weight of 521.60 g/mol. Its IUPAC name is 4-[3-(1H-indol-5-yl)-4-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-methoxybenzaldehyde.
| Compound Name | 4-[3-(1H-indol-5-yl)-4-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 123430375 |
| Molecular Formula | C30H23N3O4S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 4-[3-(1H-indol-5-yl)-4-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-methoxybenzaldehyde |
| SMILES | COc1cc(-c2cnc3[nH]cc(-c4ccc5[nH]ccc5c4)c3c2S(=O)(=O)c2ccc(C)cc2)ccc1C=O |
| InChI | InChI=1S/C30H23N3O4S/c1-18-3-8-23(9-4-18)38(35,36)29-25(20-5-6-22(17-34)27(14-20)37-2)16-33-30-28(29)24(15-32-30)19-7-10-26-21(13-19)11-12-31-26/h3-17,31H,1-2H3,(H,32,33) |
| InChIKey | GNCQMFVSZIMCAT-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|