C8H9F4NO6S — CID 123435068
(2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate (PubChem CID 123435068) has the molecular formula C8H9F4NO6S and a molecular weight of 323.22 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate |
|---|---|
| PubChem CID | 123435068 |
| Molecular Formula | C8H9F4NO6S |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate |
| SMILES | O=S(=O)(On1c(O)ccc1O)C(F)(F)C(F)(F)CCO |
| InChI | InChI=1S/C8H9F4NO6S/c9-7(10,3-4-14)8(11,12)20(17,18)19-13-5(15)1-2-6(13)16/h1-2,14-16H,3-4H2 |
| InChIKey | HKWCMJFYIBOERZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|