C30H38O9 — CID 123437025
(4-acetyloxy-1,10-dihydroxy-11,15,18,18-tetramethyl-12,13-dioxo-7-oxatetracyclo[12.3.1.03,11.05,8]octadecan-2-yl) benzoate (PubChem CID 123437025) has the molecular formula C30H38O9 and a molecular weight of 542.63 g/mol. Its IUPAC name is (4-acetyloxy-1,10-dihydroxy-11,15,18,18-tetramethyl-12,13-dioxo-7-oxatetracyclo[12.3.1.03,11.05,8]octadecan-2-yl) benzoate.
| Compound Name | (4-acetyloxy-1,10-dihydroxy-11,15,18,18-tetramethyl-12,13-dioxo-7-oxatetracyclo[12.3.1.03,11.05,8]octadecan-2-yl) benzoate |
|---|---|
| PubChem CID | 123437025 |
| Molecular Formula | C30H38O9 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | (4-acetyloxy-1,10-dihydroxy-11,15,18,18-tetramethyl-12,13-dioxo-7-oxatetracyclo[12.3.1.03,11.05,8]octadecan-2-yl) benzoate |
| SMILES | CC(=O)OC1C2COC2CC(O)C2(C)C(=O)C(=O)C3C(C)CCC(O)(C(OC(=O)c4ccccc4)C12)C3(C)C |
| InChI | InChI=1S/C30H38O9/c1-15-11-12-30(36)26(39-27(35)17-9-7-6-8-10-17)22-24(38-16(2)31)18-14-37-19(18)13-20(32)29(22,5)25(34)23(33)21(15)28(30,3)4/h6-10,15,18-22,24,26,32,36H,11-14H2,1-5H3 |
| InChIKey | YBRXWHQOWGZJIV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|