C20H30O5 — CID 91448500
1,9-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecane-11,12-dione (PubChem CID 91448500) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1,9-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecane-11,12-dione.
| Compound Name | 1,9-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecane-11,12-dione |
|---|---|
| PubChem CID | 91448500 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1,9-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecane-11,12-dione |
| SMILES | CC1CCC2(O)CC3C4COC4CC(O)C3(C)C(=O)C(=O)C1C2(C)C |
| InChI | InChI=1S/C20H30O5/c1-10-5-6-20(24)8-12-11-9-25-13(11)7-14(21)19(12,4)17(23)16(22)15(10)18(20,2)3/h10-15,21,24H,5-9H2,1-4H3 |
| InChIKey | XVTGOBDEKCXLOY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|