C21H33NO5 — CID 123780183
9-hydroxy-10,14,17,17-tetramethyl-1-(methylaminooxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecane-11,12-dione (PubChem CID 123780183) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is 9-hydroxy-10,14,17,17-tetramethyl-1-(methylaminooxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecane-11,12-dione.
| Compound Name | 9-hydroxy-10,14,17,17-tetramethyl-1-(methylaminooxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecane-11,12-dione |
|---|---|
| PubChem CID | 123780183 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 9-hydroxy-10,14,17,17-tetramethyl-1-(methylaminooxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecane-11,12-dione |
| SMILES | CNOC12CCC(C)C(C(=O)C(=O)C3(C)C(O)CC4OCC4C3C1)C2(C)C |
| InChI | InChI=1S/C21H33NO5/c1-11-6-7-21(27-22-5)9-13-12-10-26-14(12)8-15(23)20(13,4)18(25)17(24)16(11)19(21,2)3/h11-16,22-23H,6-10H2,1-5H3 |
| InChIKey | JZFNUSPIVKDNNE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|